
CAS 93841-13-5
:1-Piperazinepropanesulfonic acid
Description:
1-Piperazinepropanesulfonic acid, commonly referred to as Propane-1-sulfonic acid, is an organic compound characterized by its sulfonic acid functional group attached to a piperazine ring. This compound is typically a white crystalline solid that is soluble in water, making it useful in various biochemical applications. It serves as a buffering agent, particularly in biological and biochemical research, due to its ability to maintain stable pH levels in solutions. The piperazine moiety contributes to its basic properties, while the sulfonic acid group imparts strong acidity. This dual functionality allows it to interact effectively with a range of biological molecules. Additionally, 1-Piperazinepropanesulfonic acid is often utilized in the formulation of buffers for electrophoresis and chromatography, as well as in cell culture media. Its stability and compatibility with various biological systems make it a valuable reagent in laboratory settings. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C7H16N2O3S
InChI:InChI=1S/C7H16N2O3S/c10-13(11,12)7-1-4-9-5-2-8-3-6-9/h8H,1-7H2,(H,10,11,12)
InChI key:InChIKey=QGZSANLMUAESBT-UHFFFAOYSA-N
SMILES:C(CCS(=O)(=O)O)N1CCNCC1
Synonyms:- 1-Piperazinepropanesulfonic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.