CymitQuimica logo

CAS 93841-18-0

:

1-(2-Isocyanatoethyl)naphthalene

Description:
1-(2-Isocyanatoethyl)naphthalene is an organic compound characterized by the presence of both a naphthalene ring and an isocyanate functional group. This compound features a naphthalene moiety, which contributes to its aromatic properties, and an isocyanate group (-N=C=O) that is known for its reactivity, particularly in forming urethanes and other derivatives through nucleophilic addition reactions. The presence of the isocyanate group makes this compound useful in various applications, including the synthesis of polymers and as a building block in organic synthesis. It is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Due to the isocyanate functionality, it may pose health risks, including respiratory irritation and sensitization, necessitating appropriate handling and safety measures. Overall, 1-(2-Isocyanatoethyl)naphthalene is a valuable compound in the field of organic chemistry and materials science, particularly in the development of advanced materials and coatings.
Formula:C13H11NO
InChI:InChI=1S/C13H11NO/c15-10-14-9-8-12-6-3-5-11-4-1-2-7-13(11)12/h1-7H,8-9H2
InChI key:InChIKey=PUZZJOQLEUZSGS-UHFFFAOYSA-N
SMILES:C(CN=C=O)C=1C2=C(C=CC1)C=CC=C2
Synonyms:
  • 1-(2-Isocyanatoethyl)naphthalene
  • Naphthalene, 1-(2-isocyanatoethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.