CAS 93841-20-4

1-Methoxy-4-piperidinol

Description:

1-Methoxy-4-piperidinol, with the CAS number 93841-20-4, is an organic compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. This compound features a methoxy group (-OCH3) and a hydroxyl group (-OH) attached to the piperidine ring, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of both the methoxy and hydroxyl groups makes it a polar molecule, which can influence its solubility in various solvents, often making it soluble in water and organic solvents. 1-Methoxy-4-piperidinol may exhibit biological activity, making it of interest in medicinal chemistry and pharmaceutical research. Its reactivity can be attributed to the functional groups present, allowing for potential derivatization and use in synthesizing other chemical entities. As with many organic compounds, safety precautions should be observed when handling this substance, including the use of appropriate personal protective equipment.

Formula: C₆H₁₃NO₂

InChI: InChI=1S/C6H13NO2/c1-9-7-4-2-6(8)3-5-7/h6,8H,2-5H2,1H3

InChI key: InChIKey=SMXILXHGRZEYOP-UHFFFAOYSA-N

SMILES: O(C)N1CCC(O)CC1

Synonyms:

• 1-Methoxypiperidin-4-ol
• 4-Piperidinol, 1-methoxy-
• 1-Methoxy-4-piperidinol