CAS 93841-50-0

6H-Pyrido[4,3-b]carbazolium, 9-methoxy-2,5,11-trimethyl-, iodide (1:1)

Description:

6H-Pyrido[4,3-b]carbazolium, 9-methoxy-2,5,11-trimethyl-, iodide (1:1), with the CAS number 93841-50-0, is a quaternary ammonium compound characterized by its complex polycyclic structure, which includes a pyridine and carbazole moiety. This compound typically exhibits a deep color, often associated with its aromatic nature, and is soluble in polar organic solvents. Its iodide form indicates the presence of iodide ions, which can influence its reactivity and solubility. The methoxy and trimethyl groups contribute to its overall hydrophobic character and may affect its electronic properties, making it of interest in various applications, including organic electronics and photonic devices. Additionally, the presence of multiple methyl groups can enhance its stability and alter its interaction with biological systems, potentially leading to applications in medicinal chemistry. Overall, this compound's unique structure and properties make it a subject of interest in both synthetic and applied chemistry.

Formula: C₁₉H₁₉N₂O·I

InChI: InChI=1S/C19H18N2O.HI/c1-11-16-10-21(3)8-7-14(16)12(2)19-18(11)15-9-13(22-4)5-6-17(15)20-19;/h5-10H,1-4H3;1H

InChI key: InChIKey=UMHIZUSDRRRZIC-UHFFFAOYSA-N

SMILES: CC1=C2C=3C(NC2=C(C)C=4C1=C[N+](C)=CC4)=CC=C(OC)C3.[I-]

Synonyms:

• 6H-Pyrido[4,3-b]carbazolium, 9-methoxy-2,5,11-trimethyl-, iodide (1:1)
• 6H-Pyrido[4,3-b]carbazolium, 9-methoxy-2,5,11-trimethyl-, iodide
• 9-Methoxy-2-methylellipticinium iodide

APSR-IN-8

CAS: 93841-50-0

APSR-IN-8: First-in-class APS reductase inhibitor, key for sulfate use and cysteine biosynthesis.

Formula: C₁₉H₁₉IN₂O

Color and Shape: Solid

Molecular weight: 418.28

Ref: TM-T68291