CAS 938443-21-1
:4-(2,7-dichloropyrido[2,3-d]pyrimidin-4-yl)morpholine
Description:
4-(2,7-Dichloropyrido[2,3-d]pyrimidin-4-yl)morpholine is a chemical compound characterized by its complex structure, which includes a pyrido-pyrimidine core and a morpholine moiety. This compound features two chlorine atoms at the 2 and 7 positions of the pyridine ring, contributing to its unique reactivity and potential biological activity. The morpholine group enhances its solubility and may influence its pharmacokinetic properties. Typically, such compounds are of interest in medicinal chemistry due to their potential as therapeutic agents, particularly in the fields of oncology or infectious diseases. The presence of halogen substituents often affects the compound's lipophilicity and binding affinity to biological targets. Additionally, the compound's molecular structure suggests it may engage in hydrogen bonding and other interactions, which are crucial for its biological function. As with many synthetic organic compounds, safety and handling precautions are essential, given the potential toxicity associated with halogenated compounds.
Formula:C11H10Cl2N4O
InChI:InChI=1/C11H10Cl2N4O/c12-8-2-1-7-9(14-8)15-11(13)16-10(7)17-3-5-18-6-4-17/h1-2H,3-6H2
SMILES:c1cc(Cl)nc2c1c(nc(Cl)n2)N1CCOCC1
Synonyms:- 2,7-Dichlor-4-(morpholin-4-yl)pyrido[2,3-d]pyrimidin
- 2,7-Dichloro-4-(Morpholin-4-Yl)Pyrido[2,3-D]Pyrimidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-(2,7-Dichloropyrido[2,3-d]pyrimidin-4-yl)morpholine
CAS:Formula:C11H10Cl2N4OMolecular weight:285.1293
