CAS 938458-56-1

[2-(methoxymethoxy)phenyl]-(4-pyridyl)methanone

Description:

[2-(Methoxymethoxy)phenyl]-(4-pyridyl)methanone, identified by its CAS number 938458-56-1, is an organic compound characterized by its complex structure that includes a phenyl ring substituted with a methoxymethoxy group and a pyridyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, which may influence its reactivity and interaction with biological systems. The presence of the methoxymethoxy group suggests potential for solubility in organic solvents and may enhance its lipophilicity, while the pyridyl moiety can contribute to hydrogen bonding and coordination with metal ions. Such structural features may also impart specific pharmacological activities, making it of interest in medicinal chemistry. Additionally, the compound's stability, melting point, and solubility characteristics would depend on the specific conditions under which it is studied. Overall, [2-(methoxymethoxy)phenyl]-(4-pyridyl)methanone represents a versatile scaffold for further chemical exploration and potential applications in drug development.

Formula: C₁₄H₁₃NO₃

InChI: InChI=1/C14H13NO3/c1-17-10-18-13-5-3-2-4-12(13)14(16)11-6-8-15-9-7-11/h2-9H,10H2,1H3

SMILES: COCOc1ccccc1C(=O)c1ccncc1

[2-(methoxymethoxy)phenyl](pyridin-4-yl)methanone

CAS: 938458-56-1

Formula: C₁₄H₁₃NO₃

Purity: 95.0%

Molecular weight: 243.262

Ref: 10-F308017