CAS 938458-58-3

[4-(Methoxymethoxy)phenyl]-4-pyridinylmethanone

Description:

[4-(Methoxymethoxy)phenyl]-4-pyridinylmethanone, identified by its CAS number 938458-58-3, is a chemical compound characterized by its complex structure that includes a phenyl ring substituted with a methoxymethoxy group and a pyridinylmethanone moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, which may include moderate to high stability under standard conditions. Its methoxy groups can influence its solubility in organic solvents, often enhancing its lipophilicity. The presence of the pyridine ring suggests potential biological activity, as pyridine derivatives are known for their roles in pharmaceuticals and agrochemicals. Additionally, the compound may exhibit specific reactivity patterns due to the functional groups present, making it of interest in synthetic organic chemistry. Overall, the characteristics of this compound make it a subject of interest for further research in medicinal chemistry and material science.

Formula: C₁₄H₁₃NO₃

InChI: InChI=1S/C14H13NO3/c1-17-10-18-13-4-2-11(3-5-13)14(16)12-6-8-15-9-7-12/h2-9H,10H2,1H3

InChI key: InChIKey=GFLVNFFIWIMYBW-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC=C(OCOC)C=C1)C=2C=CN=CC2

Synonyms:

• [4-(Methoxymethoxy)phenyl]-4-pyridinylmethanone
• Methanone, [4-(methoxymethoxy)phenyl]-4-pyridinyl-

[4-(methoxymethoxy)phenyl](pyridin-4-yl)methanone

CAS: 938458-58-3

Formula: C₁₄H₁₃NO₃

Purity: 95.0%

Molecular weight: 243.262

Ref: 10-F308019