CAS 938458-64-1

(3-chlorophenyl)-[3-(methoxymethoxy)phenyl]methanone

Description:

The chemical substance known as (3-chlorophenyl)-[3-(methoxymethoxy)phenyl]methanone, with the CAS number 938458-64-1, is an organic compound characterized by its complex structure, which includes a chlorophenyl group and a methoxymethoxyphenyl moiety. This compound typically exhibits properties associated with aromatic ketones, such as a relatively high melting point and solubility in organic solvents. The presence of the chlorine atom introduces electronegative characteristics, which can influence its reactivity and interaction with biological systems. The methoxymethoxy group enhances the compound's lipophilicity, potentially affecting its pharmacokinetic properties. Such compounds are often studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The specific reactivity and stability of this compound can be influenced by factors such as pH, temperature, and the presence of other functional groups. Overall, (3-chlorophenyl)-[3-(methoxymethoxy)phenyl]methanone represents a class of compounds with diverse applications in chemical research and industry.

Formula: C₁₅H₁₃ClO₃

InChI: InChI=1/C15H13ClO3/c1-18-10-19-14-7-3-5-12(9-14)15(17)11-4-2-6-13(16)8-11/h2-9H,10H2,1H3

SMILES: COCOc1cccc(c1)C(=O)c1cccc(c1)Cl