CAS 938458-66-3

(3-chlorophenyl)-[4-(methoxymethoxy)phenyl]methanone

Description:

The chemical substance known as (3-chlorophenyl)-[4-(methoxymethoxy)phenyl]methanone, with the CAS number 938458-66-3, is an organic compound characterized by its complex structure, which includes a chlorophenyl group and a methoxymethoxy-substituted phenyl moiety. This compound typically exhibits properties associated with aromatic ketones, including potential solubility in organic solvents and moderate stability under standard conditions. The presence of the chlorine atom may impart specific electronic and steric effects, influencing its reactivity and interaction with biological systems. The methoxymethoxy group can enhance solubility and may also affect the compound's pharmacokinetic properties if it is evaluated for biological activity. Overall, this compound's unique structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals or agrochemicals, although specific biological activities would require empirical investigation.

Formula: C₁₅H₁₃ClO₃

InChI: InChI=1/C15H13ClO3/c1-18-10-19-14-7-5-11(6-8-14)15(17)12-3-2-4-13(16)9-12/h2-9H,10H2,1H3

SMILES: COCOc1ccc(cc1)C(=O)c1cccc(c1)Cl

(3-chlorophenyl)[4-(methoxymethoxy)phenyl]methanone

CAS: 938458-66-3

Formula: C₁₅H₁₃ClO₃

Purity: 95.0%

Molecular weight: 276.72

Ref: 10-F308024