
CAS 938458-75-4
:1-(1H-Indazol-5-yl)-4-piperidinone
Description:
1-(1H-Indazol-5-yl)-4-piperidinone, identified by its CAS number 938458-75-4, is a chemical compound characterized by its unique structural features, which include an indazole ring fused with a piperidinone moiety. This compound typically exhibits properties associated with both heterocyclic and cyclic amine structures, contributing to its potential biological activity. The indazole portion is known for its involvement in various pharmacological activities, while the piperidinone structure may enhance its solubility and reactivity. The compound is often studied in medicinal chemistry for its potential applications in drug development, particularly in the fields of neuropharmacology and oncology. Its molecular interactions can be influenced by the presence of functional groups, which may affect its binding affinity to biological targets. Additionally, the compound's stability, solubility, and reactivity can vary based on environmental conditions and the presence of other chemical entities. Overall, 1-(1H-Indazol-5-yl)-4-piperidinone represents a significant interest in research due to its structural complexity and potential therapeutic implications.
Formula:C12H13N3O
InChI:InChI=1S/C12H13N3O/c16-11-3-5-15(6-4-11)10-1-2-12-9(7-10)8-13-14-12/h1-2,7-8H,3-6H2,(H,13,14)
InChI key:InChIKey=QUOPDAVBCGRZQF-UHFFFAOYSA-N
SMILES:O=C1CCN(C=2C=C3C(=CC2)NN=C3)CC1
Synonyms:- 4-Piperidinone, 1-(1H-indazol-5-yl)-
- 1-(1H-Indazol-5-yl)-4-piperidinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.