CAS 938458-77-6

1-(4-fluoro-2-methyl-phenyl)piperidin-4-one

Description:

1-(4-fluoro-2-methyl-phenyl)piperidin-4-one, identified by its CAS number 938458-77-6, is a chemical compound that belongs to the class of piperidinones. This substance features a piperidine ring, which is a six-membered nitrogen-containing heterocycle, substituted with a 4-fluoro-2-methylphenyl group at one position and a ketone functional group at the 4-position of the piperidine ring. The presence of the fluorine atom and the methyl group on the phenyl ring contributes to its unique electronic and steric properties, potentially influencing its biological activity and interactions. This compound may exhibit various pharmacological effects, making it of interest in medicinal chemistry and drug development. Its structural characteristics suggest potential applications in the synthesis of other complex molecules or as a lead compound in the search for new therapeutic agents. As with many organic compounds, its stability, solubility, and reactivity can vary based on environmental conditions and the presence of other functional groups.

Formula: C₁₂H₁₄FNO

InChI: InChI=1/C12H14FNO/c1-9-8-10(13)2-3-12(9)14-6-4-11(15)5-7-14/h2-3,8H,4-7H2,1H3

SMILES: Cc1cc(ccc1N1CCC(=O)CC1)F

1-(4-fluoro-2-methylphenyl)piperidin-4-one

CAS: 938458-77-6

Formula: C₁₂H₁₄FNO

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 207.248

Ref: 10-F308052