CAS 938458-82-3
:spiro[2.5]octan-2-ylmethanamine
Description:
Spiro[2.5]octan-2-ylmethanamine is a chemical compound characterized by its unique spirocyclic structure, which consists of a bicyclic framework where two rings share a single carbon atom. This compound features an amine functional group, which contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The presence of the spiro configuration often imparts interesting stereochemical properties, influencing the compound's biological activity and interaction with various receptors. Typically, spiro compounds exhibit distinct physical properties, such as boiling and melting points, which can vary significantly based on their molecular structure and substituents. The amine group can participate in hydrogen bonding, affecting solubility in polar solvents. Additionally, spiro[2.5]octan-2-ylmethanamine may serve as a building block in the synthesis of more complex molecules, potentially leading to the development of pharmaceuticals or agrochemicals. Its specific characteristics, including reactivity and stability, would depend on the surrounding chemical environment and the presence of other functional groups.
Formula:C9H17N
InChI:InChI=1/C9H17N/c10-7-8-6-9(8)4-2-1-3-5-9/h8H,1-7,10H2
SMILES:C1CCC2(CC1)CC2CN
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
