CAS 938458-89-0
:2-amino-6-isopropyl-pyrimidine-4-carboxylic acid
Description:
2-Amino-6-isopropyl-pyrimidine-4-carboxylic acid is a heterocyclic organic compound characterized by its pyrimidine ring structure, which contains both amino and carboxylic acid functional groups. This compound features an isopropyl group at the 6-position of the pyrimidine ring, contributing to its hydrophobic characteristics. The presence of the amino group at the 2-position and the carboxylic acid at the 4-position enhances its potential for hydrogen bonding, making it soluble in polar solvents. This compound may exhibit biological activity, potentially serving as a building block in pharmaceuticals or agrochemicals. Its molecular structure allows for various chemical reactions, including esterification and amide formation, which can be utilized in synthetic organic chemistry. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 2-amino-6-isopropyl-pyrimidine-4-carboxylic acid is a versatile compound with potential applications in medicinal chemistry and material science.
Formula:C8H11N3O2
InChI:InChI=1/C8H11N3O2/c1-4(2)5-3-6(7(12)13)11-8(9)10-5/h3-4H,1-2H3,(H,12,13)(H2,9,10,11)
SMILES:CC(C)c1cc(C(=O)O)nc(=N)[nH]1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
