CAS 938458-90-3
:2-amino-6-isobutyl-pyrimidine-4-carboxylic acid
Description:
2-amino-6-isobutyl-pyrimidine-4-carboxylic acid is a pyrimidine derivative characterized by its amino and carboxylic acid functional groups, which contribute to its potential as a bioactive compound. The presence of the isobutyl group enhances its hydrophobic properties, influencing its solubility and interaction with biological systems. This compound typically exhibits moderate to high polarity due to the carboxylic acid and amino groups, which can participate in hydrogen bonding. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Additionally, the compound may exhibit various biological activities, including antimicrobial or anti-inflammatory properties, although specific biological data would depend on empirical studies. The CAS number 938458-90-3 uniquely identifies this substance, facilitating its recognition in chemical databases and literature. Overall, 2-amino-6-isobutyl-pyrimidine-4-carboxylic acid represents a versatile scaffold for further chemical modifications and research into its pharmacological potential.
Formula:C9H13N3O2
InChI:InChI=1/C9H13N3O2/c1-5(2)3-6-4-7(8(13)14)12-9(10)11-6/h4-5H,3H2,1-2H3,(H,13,14)(H2,10,11,12)
SMILES:CC(C)Cc1cc(C(=O)O)nc(=N)[nH]1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
