CAS 938458-96-9

1-[4-(1-Pyrrolidinylmethyl)-2-thienyl]ethanone

Description:

1-[4-(1-Pyrrolidinylmethyl)-2-thienyl]ethanone, with the CAS number 938458-96-9, is a synthetic organic compound characterized by its unique structural features. It contains a thienyl ring, which is a five-membered aromatic ring containing sulfur, and a pyrrolidinyl group, which is a five-membered nitrogen-containing ring. The presence of the ethanone functional group indicates that it is a ketone, contributing to its reactivity and potential applications in organic synthesis. This compound may exhibit various biological activities due to its structural components, making it of interest in medicinal chemistry and drug development. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. As with many synthetic compounds, safety and handling precautions should be observed, as the specific toxicity and safety profile would depend on empirical studies. Overall, 1-[4-(1-Pyrrolidinylmethyl)-2-thienyl]ethanone represents a class of compounds that may have significant implications in research and pharmaceutical applications.

Formula: C₁₁H₁₅NOS

InChI: InChI=1/C11H15NOS/c1-9(13)11-6-10(8-14-11)7-12-4-2-3-5-12/h6,8H,2-5,7H2,1H3

InChI key: InChIKey=GVRGMBBQSPKGIG-UHFFFAOYSA-N

SMILES: C(C=1C=C(C(C)=O)SC1)N2CCCC2

Synonyms:

• 1-[4-(1-Pyrrolidinylmethyl)-2-thienyl]ethanone
• Ethanone, 1-[4-(1-pyrrolidinylmethyl)-2-thienyl]-

1-[4-(pyrrolidin-1-ylmethyl)-2-thienyl]ethanone

CAS: 938458-96-9

Formula: C₁₁H₁₅NOS

Purity: 95.0%

Color and Shape: Liquid, No data available.

Molecular weight: 209.31

Ref: 10-F308727