CAS 938458-97-0

Benzoxazole, 5-bromo-2-(methoxymethyl)-

Description:

Benzoxazole, 5-bromo-2-(methoxymethyl)- is a heterocyclic organic compound characterized by the presence of a benzoxazole ring, which consists of a fused benzene and oxazole moiety. The compound features a bromine atom at the 5-position and a methoxymethyl group at the 2-position of the benzoxazole ring, contributing to its unique chemical properties. This structure imparts specific reactivity and solubility characteristics, making it of interest in various chemical applications, including medicinal chemistry and material science. The presence of the bromine atom can enhance the compound's reactivity in electrophilic substitution reactions, while the methoxymethyl group may influence its solubility and interaction with biological targets. Additionally, benzoxazole derivatives are often studied for their potential biological activities, including antimicrobial and anticancer properties. Overall, the compound's distinct structural features and functional groups make it a valuable subject of study in organic synthesis and pharmaceutical research.

Formula: C₉H₈BrNO₂

InChI: InChI=1S/C9H8BrNO2/c1-12-5-9-11-7-4-6(10)2-3-8(7)13-9/h2-4H,5H2,1H3

InChI key: InChIKey=LMBMCMJRMKBCEZ-UHFFFAOYSA-N

SMILES: C(OC)C1=NC=2C(O1)=CC=C(Br)C2

Synonyms:

• 5-Bromo-2-methoxymethylbenzoxazole
• Benzoxazole, 5-bromo-2-(methoxymethyl)-