CAS 938458-98-1

1-(2-Methoxyethyl)-N-methyl-4-piperidinemethanamine

Description:

1-(2-Methoxyethyl)-N-methyl-4-piperidinemethanamine, identified by its CAS number 938458-98-1, is a chemical compound that belongs to the class of piperidine derivatives. This substance features a piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle, and is substituted with a methoxyethyl group and a methyl group on the nitrogen atom. The presence of the methoxyethyl group contributes to its solubility in organic solvents and may influence its biological activity. The compound is typically characterized by its molecular structure, which includes functional groups that can participate in various chemical reactions. It may exhibit properties such as moderate polarity, potential for hydrogen bonding, and specific reactivity due to the presence of the amine functional group. While specific physical properties like melting point, boiling point, and solubility can vary, they are essential for understanding its behavior in different environments. This compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting the central nervous system or other therapeutic areas.

Formula: C₁₀H₂₂N₂O

InChI: InChI=1S/C10H22N2O/c1-11-9-10-3-5-12(6-4-10)7-8-13-2/h10-11H,3-9H2,1-2H3

InChI key: InChIKey=NNSYLBINUCUDMD-UHFFFAOYSA-N

SMILES: C(COC)N1CCC(CNC)CC1

Synonyms:

• 1-[1-(2-Methoxyethyl)piperidin-4-yl]-N-methylmethanamine
• 1-(2-Methoxyethyl)-N-methyl-4-piperidinemethanamine
• [[1-(2-Methoxyethyl)piperidin-4-yl]methyl](methyl)amine
• 4-Piperidinemethanamine, 1-(2-methoxyethyl)-N-methyl-

1-[1-(2-methoxyethyl)piperidin-4-yl]-N-methylmethanamine

CAS: 938458-98-1

Formula: C₁₀H₂₂N₂O

Purity: 95.0%

Color and Shape: Liquid

Molecular weight: 186.299

Ref: 10-F308745