CAS 938459-00-8

1-Piperidinecarbothioamide, 2-methyl-

Description:

1-Piperidinecarbothioamide, 2-methyl- is an organic compound characterized by the presence of a piperidine ring, which is a six-membered saturated nitrogen-containing heterocycle. This compound features a carbothioamide functional group, indicating the presence of a carbonyl group (C=O) bonded to a sulfur atom (S) and an amine (NH2) group. The "2-methyl" designation indicates that a methyl group is attached to the second carbon of the piperidine ring, influencing the compound's steric and electronic properties. This structure contributes to its potential biological activity and reactivity. The compound may exhibit characteristics typical of thioamides, such as being a potential nucleophile and participating in various chemical reactions, including condensation and substitution reactions. Additionally, the presence of the piperidine moiety may impart certain pharmacological properties, making it of interest in medicinal chemistry. Overall, 1-Piperidinecarbothioamide, 2-methyl- is a compound with unique structural features that may lead to diverse applications in chemical synthesis and drug development.

Formula: C₇H₁₄N₂S

InChI: InChI=1S/C7H14N2S/c1-6-4-2-3-5-9(6)7(8)10/h6H,2-5H2,1H3,(H2,8,10)

InChI key: InChIKey=YBOYYKMMFLBHPT-UHFFFAOYSA-N

SMILES: C(N)(=S)N1C(C)CCCC1

Synonyms:

• 1-Piperidinecarbothioamide, 2-methyl-
• 2-Methylpiperidine-1-carbothioamide