CAS 938459-03-1
:N1-Cyclopentyl-N1,N2-dimethyl-1,2-ethanediamine
Description:
N1-Cyclopentyl-N1,N2-dimethyl-1,2-ethanediamine is an organic compound characterized by its unique structure, which includes a cyclopentyl group and two methyl groups attached to a 1,2-ethanediamine backbone. This compound features two amine functional groups, which contribute to its basicity and potential reactivity in various chemical environments. The presence of the cyclopentyl ring adds to its steric properties, influencing its interactions with other molecules. Typically, compounds like this may exhibit solubility in polar solvents due to the amine groups, while the cyclopentyl moiety may impart hydrophobic characteristics. This compound may be of interest in medicinal chemistry and materials science due to its potential biological activity and ability to act as a ligand in coordination chemistry. Additionally, its structural features may allow for specific interactions with biological targets, making it a candidate for further research in drug development or as a building block in synthetic chemistry. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C9H20N2
InChI:InChI=1S/C9H20N2/c1-10-7-8-11(2)9-5-3-4-6-9/h9-10H,3-8H2,1-2H3
InChI key:InChIKey=AHNPSXMOXGQMPF-UHFFFAOYSA-N
SMILES:N(CCNC)(C)C1CCCC1
Synonyms:- 1,2-Ethanediamine, N1-cyclopentyl-N1,N2-dimethyl-
- N1-Cyclopentyl-N1,N2-dimethyl-1,2-ethanediamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
