CAS 938459-07-5
:1-(2-Chloroethyl)-1,3-dihydro-2H-imidazol-2-one
Description:
1-(2-Chloroethyl)-1,3-dihydro-2H-imidazol-2-one is a chemical compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This substance features a chloroethyl group, which contributes to its reactivity and potential applications in medicinal chemistry. The presence of the chloroethyl moiety suggests that it may participate in nucleophilic substitution reactions, making it a candidate for various synthetic pathways. The dihydro form indicates that the compound may exist in a saturated state, which can influence its physical properties such as solubility and stability. Additionally, the imidazol-2-one framework is known for its biological activity, often serving as a scaffold in drug design. The compound's CAS number, 938459-07-5, allows for precise identification and retrieval of information in chemical databases. Overall, this compound's unique structure and functional groups position it as a potentially valuable entity in pharmaceutical research and development.
Formula:C5H7ClN2O
InChI:InChI=1S/C5H7ClN2O/c6-1-3-8-4-2-7-5(8)9/h2,4H,1,3H2,(H,7,9)
InChI key:InChIKey=XNTHDQDMSUWQKT-UHFFFAOYSA-N
SMILES:C(CCl)N1C(=O)NC=C1
Synonyms:- 2H-Imidazol-2-one, 1-(2-chloroethyl)-1,3-dihydro-
- 1-(2-Chloroethyl)-2,3-dihydro-1H-imidazol-2-one
- 1-(2-Chloroethyl)-1H-imidazol-2-ol
- 1-(2-Chloroethyl)-1,3-dihydro-2H-imidazol-2-one
- 1-(2-Chloroethyl)-1H-imidazol-2(3H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-(2-Chloroethyl)-1H-imidazol-2(3H)-one
CAS:Formula:C5H7ClN2OColor and Shape:SolidMolecular weight:146.5749
