CAS 938459-16-6

5-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]furan-2-carbaldehyde

Description:

5-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]furan-2-carbaldehyde is a chemical compound characterized by its unique structural features, which include a furan ring and a triazole moiety. The presence of a sulfanyl group introduces potential for reactivity, particularly in nucleophilic substitution reactions. This compound is likely to exhibit properties typical of aldehydes, such as being a reactive electrophile due to the carbonyl group, which can participate in various chemical reactions, including condensation and addition reactions. The triazole ring contributes to the compound's potential biological activity, as triazoles are known for their roles in pharmaceuticals and agrochemicals. Additionally, the methyl group on the triazole may influence the compound's solubility and stability. Overall, this compound's characteristics suggest it may have applications in medicinal chemistry or as a building block in organic synthesis, although specific biological activities or applications would require further investigation.

Formula: C₈H₇N₃O₂S

InChI: InChI=1/C8H7N3O2S/c1-11-5-9-10-8(11)14-7-3-2-6(4-12)13-7/h2-5H,1H3

SMILES: Cn1cnnc1Sc1ccc(C=O)o1

5-[(4-methyl-4H-1,2,4-triazol-3-yl)thio]-2-furaldehyde

CAS: 938459-16-6

Formula: C₈H₇N₃O₂S

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 209.22

Ref: 10-F313732