CAS 938459-19-9
:2-chloro-4-methyl-7-methylsulfanyl-quinoline
Description:
2-Chloro-4-methyl-7-methylsulfanyl-quinoline is a chemical compound characterized by its quinoline backbone, which is a bicyclic structure consisting of a benzene ring fused to a pyridine ring. The presence of a chlorine atom at the 2-position and a methyl group at the 4-position, along with a methylsulfanyl group at the 7-position, contributes to its unique chemical properties. This compound is likely to exhibit moderate lipophilicity due to the aromatic nature of the quinoline structure, which can influence its solubility and interaction with biological systems. The methylsulfanyl group may impart specific reactivity and stability characteristics, potentially affecting its behavior in chemical reactions. Additionally, the chlorine substituent can enhance the compound's electrophilicity, making it a candidate for various synthetic applications. Overall, 2-chloro-4-methyl-7-methylsulfanyl-quinoline may have potential uses in medicinal chemistry, particularly in the development of pharmaceuticals, due to its structural features that can interact with biological targets.
Formula:C11H10ClNS
InChI:InChI=1/C11H10ClNS/c1-7-5-11(12)13-10-6-8(14-2)3-4-9(7)10/h3-6H,1-2H3
SMILES:Cc1cc(Cl)nc2cc(ccc12)SC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
