CAS 938459-20-2
:2-Chloro-6,8-dimethoxy-4-methylquinoline
Description:
2-Chloro-6,8-dimethoxy-4-methylquinoline is a chemical compound belonging to the quinoline family, characterized by a bicyclic structure that includes a benzene ring fused to a pyridine ring. This compound features a chlorine atom at the 2-position and two methoxy groups at the 6 and 8 positions, along with a methyl group at the 4-position. These substituents contribute to its unique chemical properties, influencing its reactivity and potential applications. The presence of the chlorine atom can enhance the compound's electrophilic character, while the methoxy groups may provide electron-donating effects, affecting its solubility and interaction with biological systems. 2-Chloro-6,8-dimethoxy-4-methylquinoline may exhibit interesting pharmacological activities, making it a subject of interest in medicinal chemistry. Its specific characteristics, such as melting point, boiling point, and solubility, would typically be determined through experimental methods, and its safety profile would need to be assessed for any potential toxicity or environmental impact.
Formula:C12H12ClNO2
InChI:InChI=1S/C12H12ClNO2/c1-7-4-11(13)14-12-9(7)5-8(15-2)6-10(12)16-3/h4-6H,1-3H3
InChI key:InChIKey=FTTISRVTEBJLDA-UHFFFAOYSA-N
SMILES:O(C)C=1C2=C(C(C)=CC(Cl)=N2)C=C(OC)C1
Synonyms:- Quinoline, 2-chloro-6,8-dimethoxy-4-methyl-
- 2-Chloro-6,8-dimethoxy-4-methylquinoline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.