CAS 93852-40-5
:2-chloro-N-[3-(2-ethoxyphenoxy)-2-hydroxy-3-phenyl-propyl]acetamide
Description:
2-chloro-N-[3-(2-ethoxyphenoxy)-2-hydroxy-3-phenyl-propyl]acetamide, with the CAS number 93852-40-5, is a synthetic organic compound characterized by its complex structure, which includes a chloro group, an acetamide functional group, and a phenylpropyl moiety. This compound features an ethoxyphenoxy group that contributes to its hydrophobic characteristics, while the presence of hydroxyl and acetamide functionalities enhances its potential for hydrogen bonding. The chloro substituent may influence its reactivity and biological activity. Typically, compounds of this nature are investigated for their pharmacological properties, including potential applications in medicinal chemistry. The presence of multiple aromatic rings suggests possible interactions with biological targets, making it a candidate for studies in drug development. Its solubility, stability, and reactivity would depend on the specific conditions, such as pH and solvent, which are crucial for understanding its behavior in various chemical environments. Overall, this compound exemplifies the complexity often found in organic molecules designed for specific biological activities.
Formula:C19H22ClNO4
InChI:InChI=1/C19H22ClNO4/c1-2-24-16-10-6-7-11-17(16)25-19(14-8-4-3-5-9-14)15(22)13-21-18(23)12-20/h3-11,15,19,22H,2,12-13H2,1H3,(H,21,23)
SMILES:CCOc1ccccc1OC(c1ccccc1)C(CN=C(CCl)O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.