CAS 93857-63-7

6-Hydroxybenz[cd]indol-2(1H)-one

Description:

6-Hydroxybenz[cd]indol-2(1H)-one, with the CAS number 93857-63-7, is a chemical compound that belongs to the class of indole derivatives. This substance features a fused ring system that includes both indole and benzene structures, contributing to its unique chemical properties. The presence of a hydroxyl group at the 6-position enhances its reactivity and solubility in polar solvents. This compound is of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activities and applications. It may exhibit properties such as fluorescence, making it useful in imaging and sensing applications. Additionally, the structural characteristics of 6-Hydroxybenz[cd]indol-2(1H)-one may influence its interactions with biological targets, which could be relevant for drug development. However, specific information regarding its toxicity, stability, and detailed reactivity would require further investigation and empirical data. Overall, this compound represents a fascinating area of study within organic and medicinal chemistry.

Formula: C₁₁H₇NO₂

InChI: InChI=1S/C11H7NO2/c13-9-5-4-8-10-6(9)2-1-3-7(10)11(14)12-8/h1-5,13H,(H,12,14)

InChI key: InChIKey=JVBDTVFHEJJWEU-UHFFFAOYSA-N

SMILES: O=C1C2=C3C(C(O)=CC=C3N1)=CC=C2

Synonyms:

• Naphthostyril, 5-hydroxy-
• 6-Hydroxybenz[cd]indol-2(1H)-one
• Benz[cd]indol-2(1H)-one, 6-hydroxy-