CymitQuimica logo

CAS 93857-71-7

:

1,3,5-Triazin-2-ol, 4,6-dichloro-, monoester with boric acid (H3BO3), monosodium salt

Description:
1,3,5-Triazin-2-ol, 4,6-dichloro-, monoester with boric acid (H3BO3), monosodium salt, identified by CAS number 93857-71-7, is a chemical compound that exhibits characteristics typical of triazine derivatives. This substance features a triazine ring, which is a six-membered aromatic heterocycle containing three nitrogen atoms. The presence of dichloro substituents enhances its reactivity and potential applications in various fields, including agriculture and materials science. As a monoester with boric acid, it likely possesses properties that facilitate interactions with biological systems or enhance its efficacy as a pesticide or herbicide. The monosodium salt form indicates that it is soluble in water, which is advantageous for its application in aqueous formulations. Additionally, the compound may exhibit antimicrobial or herbicidal properties, making it of interest in agricultural chemistry. Overall, its unique structure and functional groups contribute to its potential utility in various chemical applications, particularly in enhancing plant growth or protecting crops from pests.
Formula:C3H2BCl2N3O3·Na
InChI:InChI=1S/C3H2BCl2N3O3.Na/c5-1-7-2(6)9-3(8-1)12-4(10)11;/h10-11H;
InChI key:InChIKey=SDWYOKBSKMSFOI-UHFFFAOYSA-N
SMILES:O(B(O)O)C=1N=C(Cl)N=C(Cl)N1.[Na]
Synonyms:
  • 1,3,5-Triazin-2-ol, 4,6-dichloro-, monoester with boric acid (H3BO3), monosodium salt
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.