CAS 93858-69-6
:2-[(2,2,3,4,4,4-Hexafluorobutoxy)methyl]oxirane
Description:
2-[(2,2,3,4,4,4-Hexafluorobutoxy)methyl]oxirane, with the CAS number 93858-69-6, is a fluorinated epoxide compound characterized by its unique structure that includes a hexafluorobutoxy group attached to an oxirane ring. This compound is notable for its high fluorine content, which imparts distinct chemical properties such as increased hydrophobicity and thermal stability. The presence of the oxirane ring suggests that it can participate in ring-opening reactions, making it useful in various chemical syntheses. Additionally, the hexafluorobutoxy moiety contributes to its potential applications in specialty coatings, surfactants, and as a building block in the synthesis of more complex fluorinated compounds. Its fluorinated nature may also enhance its performance in applications requiring chemical resistance and low surface energy. However, handling and disposal of such fluorinated compounds should be approached with caution due to environmental and health considerations associated with fluorinated substances.
Formula:C7H8F6O2
InChI:InChI=1/C7H8F6O2/c8-5(7(11,12)13)6(9,10)3-14-1-4-2-15-4/h4-5H,1-3H2
InChI key:InChIKey=OHNPHEFKAOEHSF-UHFFFAOYSA-N
SMILES:C(OCC(C(C(F)(F)F)F)(F)F)C1CO1
Synonyms:- 2,2,3,4,4,4-Hexafluorobutyl glycidyl ether
- 2-[(2,2,3,4,4,4-Hexafluorobutoxy)Methyl]Oxirane
- Oxirane, 2-[(2,2,3,4,4,4-hexafluorobutoxy)methyl]-
- Oxirane, [(2,2,3,4,4,4-hexafluorobutoxy)methyl]-
- ((2,2,3,4,4,4-Hexafluorobutoxy)methyl)oxirane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-(2,2,3,4,4,4-Hexafluorobutoxymethyl)oxirane
CAS:2-(2,2,3,4,4,4-Hexafluorobutoxymethyl)oxirane
Molecular weight:238.12764g/mol

