CAS 93866-15-0

[(1-phenyl-1H-benzimidazol-2-yl)sulfanyl]acetic acid

Description:

[(1-phenyl-1H-benzimidazol-2-yl)sulfanyl]acetic acid, with the CAS number 93866-15-0, is a chemical compound characterized by its unique structure that includes a benzimidazole moiety and a sulfanyl group attached to an acetic acid functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, which may influence its solubility, stability, and reactivity. The presence of the benzimidazole ring often imparts biological activity, making such compounds of interest in medicinal chemistry. Additionally, the sulfanyl group can enhance the compound's reactivity and potential interactions with biological targets. The acetic acid component contributes to its acidity and can participate in various chemical reactions, including esterification and amidation. Overall, this compound may be explored for its potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis, although specific biological activities and applications would require further investigation and characterization.

Formula: C₁₅H₁₂N₂O₂S

InChI: InChI=1/C15H12N2O2S/c18-14(19)10-20-15-16-12-8-4-5-9-13(12)17(15)11-6-2-1-3-7-11/h1-9H,10H2,(H,18,19)

SMILES: c1ccc(cc1)n1c2ccccc2nc1SCC(=O)O

Synonyms:

• Acetic acid, 2-[(1-phenyl-1H-benzimidazol-2-yl)thio]-
• [(1-Phenyl-1H-benzimidazol-2-yl)sulfanyl]acetic acid

(1-Phenyl-1h-benzoimidazol-2-ylsulfanyl)-acetic acid

CAS: 93866-15-0

Formula: C₁₅H₁₂N₂O₂S

Purity: 95%

Color and Shape: Solid

Molecular weight: 284.3330

Ref: IN-DA00GSQT

2-((1-Phenyl-1H-benzo[d]imidazol-2-yl)thio)acetic acid

CAS: 93866-15-0

2-((1-Phenyl-1H-benzo[d]imidazol-2-yl)thio)acetic acid

Purity: 95%

Molecular weight: 284.34g/mol

Ref: 54-OR1046444