CymitQuimica logo

CAS 93866-45-6

:

[(E)-{4-[(E)-phenyldiazenyl]phenyl}diazenyl]propanedinitrile

Description:
The chemical substance known as [(E)-{4-[(E)-phenyldiazenyl]phenyl}diazenyl]propanedinitrile, with the CAS number 93866-45-6, is a complex organic compound characterized by its azo functional groups, which are indicative of its potential use in dye applications. This compound features a propanedinitrile backbone, which contributes to its reactivity and solubility properties. The presence of the phenyldiazenyl groups suggests that it may exhibit significant chromophoric properties, making it useful in various applications, including as a dye or pigment. The E configuration of the diazenyl groups indicates a specific geometric arrangement that can influence the compound's optical properties and stability. Additionally, the presence of nitrile groups may enhance its polarity and solubility in polar solvents. Overall, this compound's unique structure and functional groups suggest potential applications in materials science, organic synthesis, and possibly in the development of novel dyes or sensors. Further studies would be necessary to fully explore its properties and applications.
Formula:C15H10N6
InChI:InChI=1/C15H10N6/c16-10-15(11-17)21-20-14-8-6-13(7-9-14)19-18-12-4-2-1-3-5-12/h1-9,15H/b19-18+,21-20+
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.