CAS 93879-40-4

3-benzyl-5-ethyl-5-phenylimidazolidine-2,4-dione

Description:

3-Benzyl-5-ethyl-5-phenylimidazolidine-2,4-dione, with the CAS number 93879-40-4, is a chemical compound characterized by its imidazolidine structure, which features a five-membered ring containing two nitrogen atoms. This compound typically exhibits properties associated with its functional groups, including potential reactivity due to the presence of the dione moiety, which can participate in various chemical reactions such as nucleophilic additions and condensation reactions. The presence of the benzyl, ethyl, and phenyl substituents contributes to its hydrophobic character and may influence its solubility in organic solvents. Additionally, the compound may exhibit biological activity, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in pharmaceuticals or as a building block in organic synthesis. As with many organic compounds, safety and handling precautions should be observed, as the specific toxicity and environmental impact would depend on its concentration and exposure levels.

Formula: C₁₈H₁₈N₂O₂

InChI: InChI=1/C18H18N2O2/c1-2-18(15-11-7-4-8-12-15)16(21)20(17(22)19-18)13-14-9-5-3-6-10-14/h3-12H,2,13H2,1H3,(H,19,22)

SMILES: CCC1(c2ccccc2)C(=O)N(Cc2ccccc2)C(=N1)O

(±)-N-3-Benzylnirvanol

CAS: 93879-40-4

(±)-N-3-Benzylnirvanol is a racemic mixture of (+)-N-3-Benzylnirvanol and (-) -n-3-Benzylnirvanoll.

Formula: C₁₈H₁₈N₂O₂

Purity: 98.31%

Color and Shape: Solid

Molecular weight: 294.35

Ref: TM-T37332

5-Ethyl-5-phenyl-3-(phenylmethyl)-2,4-imidazolidinedione

CAS: 93879-40-4

Formula: C₁₈H₁₈N₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 294.3477

Ref: IN-DA006C2B

(±)-N-3-Benzylnirvanol

CAS: 93879-40-4

(±)-N-3-Benzylnirvanol

Purity: ≥95%

Molecular weight: 294.35g/mol

Ref: 54-BUP02861

(+/-)-N-3-Benzylnirvanol

Controlled Product

CAS: 93879-40-4

Applications It is a potent and selective human CYP2C19 inhibitor.
References Suzuki, H., et al.: Drug Metab. Dispos., 30, 235 (2002), Robert, L., et al.: Drug Metab. Dispos., 31, 343 (2003),

Formula: C₁₈H₁₈N₂O₂

Color and Shape: Neat

Molecular weight: 294.35

Ref: TR-B285770

(±)-N-3-Benzylnirvanol

CAS: 93879-40-4

Purity: 98%

Molecular weight: 294.354

Ref: 10-F986881