CAS 93892-40-1
:2,3-Dihydro-1,1,3,3-tetramethyl-4,6-bis(1-methylethyl)-1H-inden-5-ol
Description:
2,3-Dihydro-1,1,3,3-tetramethyl-4,6-bis(1-methylethyl)-1H-inden-5-ol, with CAS number 93892-40-1, is a complex organic compound characterized by its unique structure that includes a bicyclic indene framework. This substance features multiple alkyl substituents, specifically two tert-butyl groups and a hydroxyl group, which contribute to its chemical properties and reactivity. The presence of the hydroxyl group indicates that it can participate in hydrogen bonding, influencing its solubility and boiling point. The compound is likely to exhibit hydrophobic characteristics due to its bulky alkyl groups, making it less soluble in polar solvents. Additionally, the steric hindrance from the tert-butyl groups may affect its reactivity and interactions with other molecules. This compound may find applications in various fields, including organic synthesis and materials science, although specific applications would depend on further research into its properties and behavior in different chemical environments. Overall, its structural complexity and functional groups suggest potential utility in specialized chemical applications.
Formula:C19H30O
InChI:InChI=1/C19H30O/c1-11(2)13-9-14-16(15(12(3)4)17(13)20)19(7,8)10-18(14,5)6/h9,11-12,20H,10H2,1-8H3
InChI key:InChIKey=WGQDDNQFNLMBOS-UHFFFAOYSA-N
SMILES:C(C)(C)C1=C2C(C(C)(C)CC2(C)C)=CC(C(C)C)=C1O
Synonyms:- 1,1,3,3-tetramethyl-4,6-di(propan-2-yl)-2,3-dihydro-1H-inden-5-ol
- 1H-Inden-5-ol, 2,3-dihydro-1,1,3,3-tetramethyl-4,6-bis(1-methylethyl)-
- 2,3-Dihydro-1,1,3,3-tetramethyl-4,6-bis(1-methylethyl)-1H-inden-5-ol
- 4,6-Bis(isopropyl)-1,1,3,3-tetramethylindan-5-ol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
