
CAS 93894-13-4
:2-(2-Butoxyethoxy)ethyl octadecanoate
Description:
2-(2-Butoxyethoxy)ethyl octadecanoate, with the CAS number 93894-13-4, is an ester compound characterized by its long hydrocarbon chain and ether functional groups. This substance typically appears as a colorless to pale yellow liquid with a relatively high molecular weight due to the presence of the octadecanoate (stearate) moiety. It is known for its low volatility and moderate solubility in organic solvents, while being less soluble in water, which is common for long-chain fatty acid esters. The presence of the butoxyethoxy group contributes to its surfactant properties, making it useful in various applications, including as an emulsifier or dispersant in formulations. Additionally, it may exhibit good thermal stability and resistance to oxidation, enhancing its utility in industrial applications. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance, to ensure proper safety measures are taken during use.
Formula:C26H52O4
InChI:InChI=1S/C26H52O4/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-18-19-20-26(27)30-25-24-29-23-22-28-21-6-4-2/h3-25H2,1-2H3
InChI key:InChIKey=JFLVPDTYNNSVGH-UHFFFAOYSA-N
SMILES:C(CCCCCCCCCCCCCCCCC)(OCCOCCOCCCC)=O
Synonyms:- Octadecanoic acid, 2-(2-butoxyethoxy)ethyl ester
- 2-(2-Butoxyethoxy)ethyl octadecanoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
