CAS 93898-91-0
:2-(2-phenylethoxy)benzaldehyde
Description:
2-(2-Phenylethoxy)benzaldehyde, with the CAS number 93898-91-0, is an organic compound characterized by its aromatic structure. It features a benzaldehyde group, which is a common functional group in organic chemistry, known for its aldehyde functionality (-CHO) attached to a benzene ring. The compound also contains a phenylethoxy group, indicating the presence of an ethoxy linkage (-O-CH2-CH(Ph)-) connected to another phenyl ring. This structure contributes to its potential applications in organic synthesis and as an intermediate in the production of various pharmaceuticals and fine chemicals. The compound is typically a colorless to pale yellow liquid with a distinct aromatic odor. Its solubility is generally higher in organic solvents than in water, reflecting its hydrophobic nature due to the presence of multiple aromatic rings. Additionally, it may exhibit moderate to low toxicity, necessitating proper handling and safety precautions during use. Overall, 2-(2-phenylethoxy)benzaldehyde is a valuable compound in the field of organic chemistry and materials science.
Formula:C15H14O2
InChI:InChI=1/C15H14O2/c16-12-14-8-4-5-9-15(14)17-11-10-13-6-2-1-3-7-13/h1-9,12H,10-11H2
SMILES:c1ccc(cc1)CCOc1ccccc1C=O
Synonyms:- Benzaldehyde, 2-(2-Phenylethoxy)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.