CAS 939-15-1
:2-bromo-3-methylnaphthalene
Description:
2-Bromo-3-methylnaphthalene is an organic compound characterized by its structure, which consists of a naphthalene backbone substituted with a bromine atom at the second position and a methyl group at the third position. This compound is part of the polycyclic aromatic hydrocarbons (PAHs) family, exhibiting typical properties such as a relatively high melting and boiling point due to its aromatic nature. It is generally a solid at room temperature and is insoluble in water but soluble in organic solvents like ethanol and ether. The presence of the bromine atom introduces reactivity, making it useful in various chemical reactions, including electrophilic substitution and cross-coupling reactions. Additionally, 2-bromo-3-methylnaphthalene can serve as an intermediate in the synthesis of more complex organic molecules. Safety precautions should be taken when handling this compound, as brominated compounds can be hazardous. Overall, its unique structure and reactivity make it a valuable compound in organic synthesis and materials science.
Formula:C11H9Br
InChI:InChI=1/C11H9Br/c1-8-6-9-4-2-3-5-10(9)7-11(8)12/h2-7H,1H3
SMILES:Cc1cc2ccccc2cc1Br
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
