CAS 939-19-5
:3-Hydroxycoumarin
Description:
3-Hydroxycoumarin, with the CAS number 939-19-5, is a chemical compound belonging to the coumarin family, characterized by its aromatic structure and a hydroxyl group at the 3-position of the coumarin ring. This compound typically appears as a white to pale yellow crystalline solid and is known for its fluorescent properties, which make it useful in various applications, including as a fluorescent marker in biochemical assays. 3-Hydroxycoumarin exhibits moderate solubility in organic solvents and limited solubility in water, which can influence its behavior in biological systems. It is also recognized for its potential pharmacological properties, including anticoagulant activity, and has been studied for its role in the synthesis of other bioactive compounds. Additionally, this compound can undergo various chemical reactions, such as esterification and oxidation, making it a versatile intermediate in organic synthesis. Safety data indicates that, while it may pose some health risks, proper handling and usage guidelines can mitigate these concerns.
Formula:C9H6O3
InChI:InChI=1S/C9H6O3/c10-7-5-6-3-1-2-4-8(6)12-9(7)11/h1-5,10H
InChI key:InChIKey=MJKVTPMWOKAVMS-UHFFFAOYSA-N
SMILES:OC1=CC=2C(OC1=O)=CC=CC2
Synonyms:- 2H-1-Benzopyran-2-one, 3-hydroxy-
- 2H-1-Benzopyran-2-one, 3-hydroxy- (9CI)
- 3-Coumarinol
- 3-Hydroxy-2H-1-benzopyran-2-one
- 3-Hydroxy-cumarin
- 3-Hydroxychromen-2-one
- 3-Hydroxycoumarin
- 3-hydroxy-2H-chromen-2-one
- Brn 0128032
- Coumarin, 3-hydroxy-
- Nsc 74691
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
3-Hydroxycoumarin
CAS:Formula:C9H6O3Purity:>98.0%(GC)(T)Color and Shape:White to Orange to Green powder to crystalMolecular weight:162.143-Hydroxycoumarin
CAS:3-Hydroxycoumarin analytical standard provided with chromatographic purity, to be used as reference material for qualitative determination.Formula:C9H6O3Purity:(HPLC) ≥95%Color and Shape:PowderMolecular weight:162.153-Hydroxycoumarin
CAS:3-Hydroxycoumarin is a natural compound, and is human 15-LOX-1 inhibitorsFormula:C9H6O3Purity:99.5% - 99.77%Color and Shape:SolidMolecular weight:162.143-Hydroxy-2H-chromen-2-one
CAS:Formula:C9H6O3Purity:97.0%Color and Shape:SolidMolecular weight:162.1443-Hydroxycoumarin
CAS:3-Hydroxycoumarin is a coumarin derivative, which is a type of organic compound with significant pharmacological interest. It is derived from the parent structure of coumarin, naturally found in various plant sources such as tonka beans and sweet clover. Its molecular structure includes a hydroxyl group added at the third position of the coumarin backbone, conferring distinct chemical properties.Formula:C9H6O3Purity:Min. 95%Color and Shape:PowderMolecular weight:162.14 g/mol








