CAS 939-53-7

N-(2-aminoethyl)pyridine-3-carboxamide

Description:

N-(2-aminoethyl)pyridine-3-carboxamide, also known by its CAS number 939-53-7, is a chemical compound characterized by its pyridine ring structure substituted with an aminoethyl group and a carboxamide functional group. This compound typically exhibits properties associated with both amines and carboxamides, such as potential solubility in polar solvents due to the presence of the amino and carboxamide groups. It may participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. The presence of the pyridine ring suggests that it may exhibit basic properties, allowing it to act as a ligand in coordination chemistry. Additionally, this compound could have applications in pharmaceuticals or as a building block in organic synthesis, given its functional groups that can participate in various chemical reactions. Its specific physical properties, such as melting point, boiling point, and solubility, would depend on the conditions and purity of the sample. Overall, N-(2-aminoethyl)pyridine-3-carboxamide is a versatile compound with potential utility in various chemical and biological contexts.

Formula: C₈H₁₁N₃O

InChI: InChI=1/C8H11N3O/c9-3-5-11-8(12)7-2-1-4-10-6-7/h1-2,4,6H,3,5,9H2,(H,11,12)

SMILES: c1cc(cnc1)C(=NCCN)O

Synonyms:

• N-(2-aminoethyl)nicotinamide