CymitQuimica logo

CAS 939016-97-4

:

(2S)-5-Amino-1,3-dihydrospiro[2H-indene-2,3′-[3H]pyrrolo[2,3-b]pyridin]-2′(1′H)-one

Description:
(2S)-5-Amino-1,3-dihydrospiro[2H-indene-2,3′-[3H]pyrrolo[2,3-b]pyridin]-2′(1′H)-one, with CAS number 939016-97-4, is a complex organic compound characterized by its unique spirocyclic structure, which combines elements of indene and pyrrolo[2,3-b]pyridine. This compound features an amino group, contributing to its potential reactivity and biological activity. The presence of stereocenters indicates that it can exist in different enantiomeric forms, which may exhibit distinct pharmacological properties. Its structural complexity suggests potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. The compound's solubility, stability, and reactivity can be influenced by its functional groups and overall molecular architecture. As with many compounds in this class, it may be of interest for research in areas such as drug design, where understanding its interactions with biological targets is crucial. Further studies would be necessary to elucidate its specific properties and potential applications in various fields, including pharmaceuticals and materials science.
Formula:C15H13N3O
InChI:InChI=1S/C15H13N3O/c16-11-4-3-9-7-15(8-10(9)6-11)12-2-1-5-17-13(12)18-14(15)19/h1-6H,7-8,16H2,(H,17,18,19)/t15-/m0/s1
InChI key:InChIKey=BWGAKJLOJFNCFI-HNNXBMFYSA-N
SMILES:O=C1[C@]2(C=3C(N1)=NC=CC3)CC=4C(C2)=CC=C(N)C4
Synonyms:
  • (2S)-5-Amino-1,3-dihydrospiro[2H-indene-2,3′-[3H]pyrrolo[2,3-b]pyridin]-2′(1′H)-one
  • Spiro[2H-indene-2,3′-[3H]pyrrolo[2,3-b]pyridin]-2′(1′H)-one, 5-amino-1,3-dihydro-, (2S)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.