CAS 939043-52-4

2,3-Difluorobenzenebutanoic acid

Description:

2,3-Difluorobenzenebutanoic acid is an organic compound characterized by its structure, which features a butanoic acid moiety attached to a benzene ring that has two fluorine substituents at the 2 and 3 positions. This compound is part of the broader class of fluorinated aromatic carboxylic acids, which are known for their unique chemical properties due to the presence of fluorine atoms. The fluorine substituents can influence the compound's reactivity, polarity, and solubility, often enhancing its stability and altering its interaction with biological systems. Typically, such compounds may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The presence of the carboxylic acid functional group contributes to its acidity and potential for forming hydrogen bonds, which can affect its behavior in various chemical environments. Overall, 2,3-Difluorobenzenebutanoic acid is a compound of interest for research and application in fields such as pharmaceuticals and agrochemicals.

Formula: C₁₀H₁₀F₂O₂

InChI: InChI=1S/C10H10F2O2/c11-8-5-1-3-7(10(8)12)4-2-6-9(13)14/h1,3,5H,2,4,6H2,(H,13,14)

InChI key: InChIKey=SWWNVUHFLDBXNF-UHFFFAOYSA-N

SMILES: C(CCC(O)=O)C1=C(F)C(F)=CC=C1

Synonyms:

• Benzenebutanoic acid, 2,3-difluoro-
• 2,3-Difluorobenzenebutanoic acid