CAS 93905-80-7

2-amino-7-(2,3,4-trihydroxybutyl)-3,7-dihydro-6H-purin-6-one

Description:

2-amino-7-(2,3,4-trihydroxybutyl)-3,7-dihydro-6H-purin-6-one, with CAS number 93905-80-7, is a purine derivative characterized by its complex structure that includes an amino group and a trihydroxybutyl side chain. This compound is part of a class of molecules known for their biological significance, particularly in relation to nucleic acids and cellular metabolism. The presence of multiple hydroxyl groups suggests that it may exhibit strong hydrogen bonding capabilities, potentially influencing its solubility and reactivity in biological systems. Additionally, the purine core is essential for various biochemical processes, including energy transfer and signal transduction. The compound may also possess antioxidant properties due to the trihydroxybutyl moiety, which can scavenge free radicals. Its specific interactions and functions would depend on the context of its use, such as in pharmaceuticals or biochemistry research. Overall, this compound exemplifies the intricate relationship between structure and function in organic chemistry and biochemistry.

Formula: C₉H₁₃N₅O₄

InChI: InChI=1/C9H13N5O4/c10-9-12-7-6(8(18)13-9)14(3-11-7)1-4(16)5(17)2-15/h3-5,15-17H,1-2H2,(H3,10,12,13,18)

SMILES: C(C(C(CO)O)O)n1cnc2c1c(nc(=N)[nH]2)O

Synonyms:

• 2-amino-7-(2,3,4-trihydroxybutyl)-1,7-dihydro-6H-purin-6-one
• 6H-purin-6-one, 2-amino-1,7-dihydro-7-(2,3,4-trihydroxybutyl)-

Guanosine Impurity 8

CAS: 93905-80-7

Formula: C₉H₁₃N₅O₄

Molecular weight: 255.23

Ref: 4Z-G-2436

N7-(2’,3’,4’-Trihydroxybutyl)guanine-d6

Controlled Product

CAS: 93905-80-7

Formula: C₉D₆H₇N₅O₄

Color and Shape: Neat

Molecular weight: 261.268

Ref: TR-T795062

N7-(2’,3’,4’-Trihydroxybutyl)guanine, >90%

Controlled Product

CAS: 93905-80-7

Applications 7-(2,3,4-Trihydroxybutyl)guanine is the major guanine adduct of diepoxybutane (DEB). N7-(2',3',4'-Trihydroxybutyl)guanine is a 1,3-butadiene DNA adduct formed in the liver of mice exposed to butadiene.
References Tretyakova, N.Y. et al.: Toxicology, 113, 70 (1996); Bolt, H.M. et al.: Toxicology, 113, 1 (1996);

Formula: C₉H₁₃N₅O₄

Purity: >90%

Color and Shape: Neat

Molecular weight: 255.23

Ref: TR-T795060