CAS 93906-75-3
:3-(1H-imidazol-1-yl)-1-phenylpropan-1-amine
Description:
3-(1H-imidazol-1-yl)-1-phenylpropan-1-amine, with the CAS number 93906-75-3, is a chemical compound characterized by its unique structure that includes an imidazole ring and a phenyl group attached to a propanamine backbone. This compound typically exhibits properties associated with both amines and heterocyclic compounds, such as basicity due to the presence of the amine functional group and potential for hydrogen bonding due to the imidazole ring. It may display moderate solubility in polar solvents, influenced by the functional groups present. The imidazole moiety can participate in various chemical reactions, making this compound of interest in medicinal chemistry and drug development, particularly for its potential biological activities. Additionally, the presence of the phenyl group may contribute to its lipophilicity, affecting its pharmacokinetic properties. Overall, this compound's characteristics make it a subject of interest for further research in various chemical and pharmaceutical applications.
Formula:C12H15N3
InChI:InChI=1/C12H15N3/c13-12(11-4-2-1-3-5-11)6-8-15-9-7-14-10-15/h1-5,7,9-10,12H,6,8,13H2
SMILES:c1ccc(cc1)C(CCn1ccnc1)N
Synonyms:- 1H-imidazole-1-propanamine, alpha-phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
