CymitQuimica logo

CAS 93913-74-7

:

arachidonic acid propyl ester

Description:
Arachidonic acid propyl ester is an ester derived from arachidonic acid, a polyunsaturated fatty acid that plays a crucial role in cellular signaling and inflammation. This compound is characterized by its long hydrocarbon chain, which contributes to its hydrophobic nature. Arachidonic acid itself is a 20-carbon fatty acid with four double bonds, making it highly unsaturated. The propyl ester form indicates that a propyl group is attached to the carboxylic acid portion of arachidonic acid, altering its solubility and reactivity. Arachidonic acid propyl ester is typically used in biochemical research and may serve as a model compound for studying lipid metabolism and signaling pathways. Its properties include being a liquid at room temperature, with potential applications in pharmaceuticals and nutraceuticals due to its role in inflammatory processes. Additionally, it may exhibit varying degrees of stability and reactivity depending on environmental conditions, such as temperature and presence of catalysts. Overall, this compound is significant in both biological and chemical contexts.
Formula:C23H38O2
InChI:InChI=1/C23H38O2/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-23(24)25-22-4-2/h8-9,11-12,14-15,17-18H,3-7,10,13,16,19-22H2,1-2H3/b9-8-,12-11-,15-14-,18-17-
SMILES:CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)OCCC
Synonyms:
  • propyl (5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.