CymitQuimica logo

CAS 93918-97-9

:

Galactaric acid, compd. with 6-methyl-N-(3-methylbutyl)-2-heptanamine (1:2)

Description:
Galactaric acid, also known as mucic acid, is a dicarboxylic acid derived from galactose, characterized by its two carboxylic acid functional groups. The compound in question, with the designation "compd. with 6-methyl-N-(3-methylbutyl)-2-heptanamine (1:2)," suggests a complex formed between galactaric acid and a specific amine, which is a branched-chain amine. This combination may exhibit unique properties due to the interactions between the carboxylic acid groups of galactaric acid and the amine functional groups. Typically, such compounds can display characteristics like increased solubility in polar solvents, potential biological activity, and varied melting and boiling points compared to their individual components. The presence of the branched amine may also influence the compound's stability and reactivity. Overall, the specific characteristics of this compound would depend on its molecular structure, including the arrangement of atoms and functional groups, which can significantly affect its chemical behavior and potential applications in fields such as pharmaceuticals or materials science.
Formula:C13H29NC6H10O8
InChI:InChI=1/C13H29N.C6H10O8/c1-11(2)7-6-8-13(5)14-10-9-12(3)4;7-1(3(9)5(11)12)2(8)4(10)6(13)14/h11-14H,6-10H2,1-5H3;1-4,7-10H,(H,11,12)(H,13,14)/t;1-,2+,3+,4-
InChI key:InChIKey=SYMNNCBHFGEDOE-OPDGLEOBNA-N
SMILES:[C@H]([C@H]([C@@H](C(O)=O)O)O)([C@H](C(O)=O)O)O.C(CCCC(C)C)(NCCC(C)C)C
Synonyms:
  • Galactaric acid, compd. with 6-methyl-N-(3-methylbutyl)-2-heptanamine (1:2)
  • 2-Heptanamine, 6-methyl-N-(3-methylbutyl)-, galactarate (2:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.