CAS 93919-00-7
:Ethyl 5-oxodecanoate
Description:
Ethyl 5-oxodecanoate, with the CAS number 93919-00-7, is an ester derived from the reaction of decanoic acid and ethanol. This compound features a five-carbon chain with a ketone functional group at the fifth position, contributing to its reactivity and potential applications in organic synthesis. Ethyl 5-oxodecanoate is typically a colorless to pale yellow liquid with a characteristic fruity odor, making it appealing for use in flavoring and fragrance industries. Its molecular structure allows for solubility in organic solvents, while its ester nature suggests it may undergo hydrolysis in the presence of water or acids. The compound may also exhibit moderate volatility and is likely to have a relatively low boiling point compared to larger, more complex esters. As with many organic compounds, safety precautions should be taken when handling ethyl 5-oxodecanoate, as it may pose health risks if inhaled or ingested. Overall, this compound is of interest for its potential applications in various chemical processes and industries.
Formula:C12H22O3
InChI:InChI=1S/C12H22O3/c1-3-5-6-8-11(13)9-7-10-12(14)15-4-2/h3-10H2,1-2H3
InChI key:InChIKey=ZAHUTEIIIFGYHV-UHFFFAOYSA-N
SMILES:C(CCCC(OCC)=O)(CCCCC)=O
Synonyms:- Ethyl 5-oxodecanoate
- Decanoic acid, 5-oxo-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.