CAS 93919-57-4

8-(Trifluoromethyl)-4(1H)-quinolinone

Description:

8-(Trifluoromethyl)-4(1H)-quinolinone is a chemical compound characterized by its quinolinone structure, which features a fused bicyclic system comprising a benzene ring and a pyridine ring. The presence of a trifluoromethyl group (-CF3) at the 8-position significantly influences its chemical properties, enhancing lipophilicity and potentially affecting its biological activity. This compound typically exhibits a pale yellow to off-white solid appearance and is soluble in organic solvents. It is often utilized in medicinal chemistry and research due to its potential as a pharmacophore in drug development, particularly in the search for novel therapeutic agents. The trifluoromethyl group can also impart unique electronic properties, making it a valuable moiety in various chemical reactions. Additionally, the compound may exhibit interesting interactions with biological targets, which can be explored in the context of drug design and development. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.

Formula: C₁₀H₆F₃NO

InChI: InChI=1S/C10H6F3NO/c11-10(12,13)7-3-1-2-6-8(15)4-5-14-9(6)7/h1-5H,(H,14,15)

InChI key: InChIKey=UDRWADJLLWWJOE-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C1=C2C(C(=O)C=CN2)=CC=C1

Synonyms:

• 8-(Trifluoromethyl)-4-quinolone
• 8-(Trifluoromethyl)-4(1H)-quinolinone
• 8-(Trifluoromethyl)quinolin-4(1H)-one
• 4(1H)-Quinolinone, 8-(trifluoromethyl)-