CymitQuimica logo

CAS 93923-72-9

:

3,6,9,12,15,18,21-Heptaoxatricosan-1-ol, 23-(4-nonylphenoxy)-, 1-(hydrogen sulfate)

Description:
3,6,9,12,15,18,21-Heptaoxatricosan-1-ol, 23-(4-nonylphenoxy)-, 1-(hydrogen sulfate) is a complex organic compound characterized by its long-chain structure, which includes multiple ether linkages and a sulfate group. The presence of seven ether oxygen atoms in its backbone contributes to its hydrophilic properties, while the nonylphenoxy group enhances its lipophilicity, making it amphiphilic. This dual nature allows the compound to interact with both aqueous and organic phases, which is beneficial in applications such as surfactants or emulsifiers. The hydrogen sulfate moiety indicates that the compound can act as a surfactant, potentially facilitating the formation of micelles or enhancing solubility in various solvents. Its molecular structure suggests potential uses in industrial applications, including detergents, personal care products, or as a dispersant in formulations. However, the environmental impact and toxicity of such compounds should be carefully evaluated, especially considering the presence of nonylphenol, which is known for its endocrine-disrupting properties. Overall, this compound exemplifies the complexity and utility of synthetic surfactants in modern chemistry.
Formula:C31H56O12S
InChI:InChI=1S/C31H56O12S/c1-2-3-4-5-6-7-8-9-30-10-12-31(13-11-30)42-28-26-40-24-22-38-20-18-36-16-14-35-15-17-37-19-21-39-23-25-41-27-29-43-44(32,33)34/h10-13H,2-9,14-29H2,1H3,(H,32,33,34)
InChI key:InChIKey=AJMIMOSFEVIRIA-UHFFFAOYSA-N
SMILES:O(CCOCCOCCOCCOCCOCCOCCOCCOS(=O)(=O)O)C1=CC=C(CCCCCCCCC)C=C1
Synonyms:
  • 3,6,9,12,15,18,21-Heptaoxatricosan-1-ol, 23-(4-nonylphenoxy)-, hydrogen sulfate
  • 3,6,9,12,15,18,21-Heptaoxatricosan-1-ol, 23-(4-nonylphenoxy)-, 1-(hydrogen sulfate)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.