CymitQuimica logo

CAS 93924-91-5

:

Boric acid (H3BO3), reaction products with 2,2′-[(C16-18 and C16-18-unsaturated alkyl)imino]bis[ethanol]

Description:
Boric acid (H3BO3) is a weak acid that exhibits unique properties, including its ability to act as a mild antiseptic, insecticide, and pH buffer. It is a colorless, odorless solid that is soluble in water, forming a slightly acidic solution. The compound is often used in various applications, including agriculture, cosmetics, and pharmaceuticals. The reaction product with 2,2′-[(C16-18 and C16-18-unsaturated alkyl)imino]bis[ethanol] involves the interaction of boric acid with a specific amine derivative that contains long-chain alkyl groups. This reaction typically results in the formation of a complex that may enhance the solubility and stability of the resulting product, potentially leading to applications in surfactants or emulsifiers. The CAS number 93924-91-5 identifies this specific compound, which is characterized by its unique structural features and potential utility in various industrial and consumer products. Overall, the combination of boric acid with long-chain alkyl amines can yield materials with enhanced properties suitable for diverse applications.
Formula:C4H11NO2·BH3O3
InChI:InChI=1S/C4H11NO2.BH3O3/c6-3-1-5-2-4-7;2-1(3)4/h5-7H,1-4H2;2-4H
InChI key:InChIKey=HRXOXDAKKRLSMI-UHFFFAOYSA-N
SMILES:B(O)(O)O.N(CCO)CCO
Synonyms:
  • Boric acid (H3BO3), reaction products with 2,2′-[(C16-18 and C16-18-unsaturated alkyl)imino]bis[ethanol]
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.