
CAS 93933-50-7
:2-[2-(Dodecyloxy)ethoxy]ethyl 3-(tetradecylthio)propanoate
Description:
2-[2-(Dodecyloxy)ethoxy]ethyl 3-(tetradecylthio)propanoate, with the CAS number 93933-50-7, is a synthetic organic compound characterized by its amphiphilic nature, which arises from the presence of both hydrophobic (long alkyl chains) and hydrophilic (ether and ester functional groups) components. This compound typically exhibits surfactant properties, making it useful in various applications such as emulsifiers, solubilizers, and dispersants in formulations. Its structure includes a dodecyloxy group and a tetradecylthio group, contributing to its hydrophobic characteristics, while the ethoxy and propanoate moieties enhance its solubility in polar solvents. The presence of long alkyl chains often leads to a high degree of lipophilicity, which can influence its behavior in biological systems and its compatibility with other substances. Additionally, this compound may exhibit unique thermal and chemical stability, making it suitable for use in various industrial and consumer products. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or environmental impact.
Formula:C33H66O4S
InChI:InChI=1S/C33H66O4S/c1-3-5-7-9-11-13-15-16-18-20-22-24-31-38-32-25-33(34)37-30-29-36-28-27-35-26-23-21-19-17-14-12-10-8-6-4-2/h3-32H2,1-2H3
InChI key:InChIKey=NDUDYGYUYSVTHK-UHFFFAOYSA-N
SMILES:O(C(CCSCCCCCCCCCCCCCC)=O)CCOCCOCCCCCCCCCCCC
Synonyms:- 2-[2-(Dodecyloxy)ethoxy]ethyl 3-(tetradecylthio)propanoate
- Propanoic acid, 3-(tetradecylthio)-, 2-[2-(dodecyloxy)ethoxy]ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Propanoic acid, 3-(tetradecylthio)-, 2-[2-(dodecyloxy)ethoxy]ethyl ester
CAS:Formula:C33H66O4SMolecular weight:558.9397
