CAS 93936-64-2
:[(E,3R,5S)-7-[1-ethyl-3-(4-fluorophenyl)indol-2-yl]-3,5-dihydroxy-hept-6-enoyl]oxysodium
Description:
The chemical substance with the name "[(E,3R,5S)-7-[1-ethyl-3-(4-fluorophenyl)indol-2-yl]-3,5-dihydroxy-hept-6-enoyl]oxysodium" and CAS number 93936-64-2 is a complex organic compound characterized by its specific stereochemistry and functional groups. It features an indole moiety substituted with an ethyl group and a para-fluorophenyl group, contributing to its potential biological activity. The presence of hydroxyl groups indicates that it may exhibit hydrogen bonding capabilities, influencing its solubility and reactivity. The hept-6-enoyl structure suggests that it has unsaturation, which can affect its stability and interactions with other molecules. As a sodium salt, it is likely to be more soluble in aqueous environments, which is important for its bioavailability in biological systems. Overall, this compound's unique structural features may confer specific pharmacological properties, making it of interest in medicinal chemistry and drug development. Further studies would be necessary to elucidate its precise biological functions and potential applications.
Formula:C23H23FNNaO4
InChI:InChI=1/C23H24FNO4.Na/c1-2-25-20-6-4-3-5-19(20)23(15-7-9-16(24)10-8-15)21(25)12-11-17(26)13-18(27)14-22(28)29;/h3-12,17-18,26-27H,2,13-14H2,1H3,(H,28,29);/q;+1/p-1/b12-11+;/t17-,18-;/m1./s1
SMILES:CCn1c2ccccc2c(c2ccc(cc2)F)c1C=CC(CC(CC(=O)O)O)O.[Na]
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Fluvastatin N-Ethyl Sodium Salt (Fluvastatin Impurity)
CAS:Controlled ProductImpurity N-Ethyl Fluvastatin Impurity
Applications Fluvastatin impurity. Fluvastatin ethyl analog; it is used as pharmaceuticals.Formula:C23H23FNNaO4Color and Shape:NeatMolecular weight:419.42(3R,5S,6E)-7-[1-ethyl-3-(4-fluorophenyl)-1H-indol-2-yl]-3,5-dihydroxy-6-heptenoic acid sodium salt
CAS:(3R,5S,6E)-7-[1-ethyl-3-(4-fluorophenyl)-1H-indol-2-yl]-3,5-dihydroxy-6-heptenoic acid sodium salt is an impurity standard for the drug product. It is a synthetic metabolite that binds to proteins and has been found in human urine. The chemical synthesis of (3R,5S,6E)-7-[1-ethyl-3-(4-fluorophenyl)-1H-indol-2-yl]-3,5-dihydroxy-6 heptenoic acid sodium salt was performed using a high purity custom synthesis and high purity pharmacopoeia grade reagents.Formula:C23H23FNNaO4Purity:Min. 95%Molecular weight:419.42 g/mol


