CAS 93940-91-1

4-Bromo-3-methyl-1,2-benzenediol

Description:

4-Bromo-3-methyl-1,2-benzenediol, also known as 4-bromo-3-methylcatechol, is an organic compound characterized by its aromatic structure featuring a bromine atom and a methyl group on a catechol backbone. This compound has two hydroxyl (-OH) groups positioned on the benzene ring, which contribute to its reactivity and solubility in polar solvents. The presence of the bromine atom enhances its electrophilic properties, making it a useful intermediate in various organic synthesis reactions. It typically appears as a solid at room temperature and may exhibit moderate to high solubility in water due to the hydroxyl groups. The compound's chemical behavior is influenced by its functional groups, allowing it to participate in substitution and oxidation reactions. Additionally, 4-bromo-3-methyl-1,2-benzenediol may have applications in pharmaceuticals, agrochemicals, and materials science, although specific uses can vary based on its reactivity and the presence of other functional groups in related compounds. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₇H₇BrO₂

InChI: InChI=1S/C7H7BrO2/c1-4-5(8)2-3-6(9)7(4)10/h2-3,9-10H,1H3

InChI key: InChIKey=SSIOQROWLGWJAH-UHFFFAOYSA-N

SMILES: CC1=C(O)C(O)=CC=C1Br

Synonyms:

• 4-Bromo-3-methyl-1,2-benzenediol
• 1,2-Benzenediol, 4-bromo-3-methyl-