
CAS 93940-92-2
:4-Amino-3-methyl-1,2-benzenediol
Description:
4-Amino-3-methyl-1,2-benzenediol, also known as 3-Methyl-4-aminocatechol, is an organic compound characterized by the presence of an amino group and two hydroxyl groups on a benzene ring. Its molecular structure features a methyl group at the 3-position and amino and hydroxyl groups at the 4- and 1,2-positions, respectively. This compound is typically a solid at room temperature and is soluble in polar solvents due to the presence of hydroxyl groups, which can engage in hydrogen bonding. It exhibits properties typical of phenolic compounds, including potential antioxidant activity. The amino group can participate in various chemical reactions, making it a versatile intermediate in organic synthesis. Additionally, it may have applications in dye manufacturing, pharmaceuticals, or as a reagent in chemical analysis. Safety data should be consulted, as with any chemical substance, to understand its handling and potential hazards.
Formula:C7H9NO2
InChI:InChI=1S/C7H9NO2/c1-4-5(8)2-3-6(9)7(4)10/h2-3,9-10H,8H2,1H3
InChI key:InChIKey=BZWJOZNPOSYQTJ-UHFFFAOYSA-N
SMILES:CC1=C(O)C(O)=CC=C1N
Synonyms:- 1,2-Benzenediol, 4-amino-3-methyl-
- 4-Amino-3-methyl-1,2-benzenediol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.